CAS 104465-32-9 is the registry number for Methyl (2S,3S)-2-(2-aminoacetamido)-3-methylpentanoate hydrochloride. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
Methyl (2S,3S)-2-[(2-aminoacetyl)amino]-3-methylpentanoate;hydrochloride (CAS 104465-32-9) is a chemical compound with the molecular formula C9H19ClN2O3 and a molecular weight of 238.71 g/mol. IUPAC name: methyl (2S,3S)-2-[(2-aminoacetyl)amino]-3-methylpentanoate;hydrochloride. InChIKey: NVEVDWFQRWEDTI-QMGYSKNISA-N.
| Molecular formula | C9H19ClN2O3 |
|---|---|
| Molecular weight | 238.71 g/mol |
| IUPAC name | methyl (2S,3S)-2-[(2-aminoacetyl)amino]-3-methylpentanoate;hydrochloride |
| InChIKey | NVEVDWFQRWEDTI-QMGYSKNISA-N |
| SMILES | CC[C@H](C)[C@@H](C(=O)OC)NC(=O)CN.Cl |
Computed by PubChem (NCBI)