CAS 2173637-55-1 is the registry number for 3-((2R)-Pyrrolidin-2-yl)-1H-1,2,4-triazole dihydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
5-[(2R)-pyrrolidin-2-yl]-1H-1,2,4-triazole;dihydrochloride (CAS 2173637-55-1) is a chemical compound with the molecular formula C6H12Cl2N4 and a molecular weight of 211.09 g/mol. IUPAC name: 5-[(2R)-pyrrolidin-2-yl]-1H-1,2,4-triazole;dihydrochloride. InChIKey: JOFNFNYRBOMTFR-ZJIMSODOSA-N.
| Molecular formula | C6H12Cl2N4 |
|---|---|
| Molecular weight | 211.09 g/mol |
| IUPAC name | 5-[(2R)-pyrrolidin-2-yl]-1H-1,2,4-triazole;dihydrochloride |
| InChIKey | JOFNFNYRBOMTFR-ZJIMSODOSA-N |
| SMILES | C1C[C@@H](NC1)C2=NC=NN2.Cl.Cl |
Computed by PubChem (NCBI)