Products 2173637-58-4
CAS 2173637-58-4 is the registry number for Ethyl (2S,3R)-2-methylpyrrolidine-3-carboxylate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Ethyl (2S,3R)-2-methylpyrrolidine-3-carboxylate (CAS 2173637-58-4) is a chemical compound with the molecular formula C8H15NO2 and a molecular weight of 157.21 g/mol. IUPAC name: ethyl (2S,3R)-2-methylpyrrolidine-3-carboxylate. InChIKey: MRIXTLRKLFKVDQ-NKWVEPMBSA-N.
| Molecular formula | C8H15NO2 |
|---|---|
| Molecular weight | 157.21 g/mol |
| IUPAC name | ethyl (2S,3R)-2-methylpyrrolidine-3-carboxylate |
| InChIKey | MRIXTLRKLFKVDQ-NKWVEPMBSA-N |
| SMILES | CCOC(=O)[C@@H]1CCN[C@H]1C |
Computed by PubChem (NCBI)