CAS 2173996-28-4 is the registry number for 5-Methyl-(1,2,4)triazolo(1,5-a)pyrimidine-7-carboxylic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
5-methyl-[1,2,4]triazolo[1,5-a]pyrimidine-7-carboxylic acid;hydrochloride (CAS 2173996-28-4) is a chemical compound with the molecular formula C7H7ClN4O2 and a molecular weight of 214.61 g/mol. IUPAC name: 5-methyl-[1,2,4]triazolo[1,5-a]pyrimidine-7-carboxylic acid;hydrochloride. InChIKey: CLXRKLSRUPVOQR-UHFFFAOYSA-N.
| Molecular formula | C7H7ClN4O2 |
|---|---|
| Molecular weight | 214.61 g/mol |
| IUPAC name | 5-methyl-[1,2,4]triazolo[1,5-a]pyrimidine-7-carboxylic acid;hydrochloride |
| InChIKey | CLXRKLSRUPVOQR-UHFFFAOYSA-N |
| SMILES | CC1=NC2=NC=NN2C(=C1)C(=O)O.Cl |
Computed by PubChem (NCBI)