CAS 4921-55-5 is the registry number for 8-Chloro-3,7-dimethyl-2,3,6,7-tetrahydro-1H-purine-2,6-dione. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
8-chloro-3,7-dimethylpurine-2,6-dione (CAS 4921-55-5) is a chemical compound with the molecular formula C7H7ClN4O2 and a molecular weight of 214.61 g/mol. IUPAC name: 8-chloro-3,7-dimethylpurine-2,6-dione. InChIKey: VCVIDOJQNAGADO-UHFFFAOYSA-N.
| Molecular formula | C7H7ClN4O2 |
|---|---|
| Molecular weight | 214.61 g/mol |
| IUPAC name | 8-chloro-3,7-dimethylpurine-2,6-dione |
| InChIKey | VCVIDOJQNAGADO-UHFFFAOYSA-N |
| SMILES | CN1C2=C(N=C1Cl)N(C(=O)NC2=O)C |
Computed by PubChem (NCBI)