CAS 2174001-68-2 is the registry number for 2-(Chloromethyl)-4H,5H,6H,7H,8H-cyclohepta(D)(1,3)thiazole hydrochloride. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
2-(chloromethyl)-5,6,7,8-tetrahydro-4H-cyclohepta[d][1,3]thiazole;hydrochloride (CAS 2174001-68-2) is a chemical compound with the molecular formula C9H13Cl2NS and a molecular weight of 238.18 g/mol. IUPAC name: 2-(chloromethyl)-5,6,7,8-tetrahydro-4H-cyclohepta[d][1,3]thiazole;hydrochloride. InChIKey: ASQNHPLPJHAWHA-UHFFFAOYSA-N.
| Molecular formula | C9H13Cl2NS |
|---|---|
| Molecular weight | 238.18 g/mol |
| IUPAC name | 2-(chloromethyl)-5,6,7,8-tetrahydro-4H-cyclohepta[d][1,3]thiazole;hydrochloride |
| InChIKey | ASQNHPLPJHAWHA-UHFFFAOYSA-N |
| SMILES | C1CCC2=C(CC1)SC(=N2)CCl.Cl |
Computed by PubChem (NCBI)