CAS 2219407-56-2 is the registry number for 2-(Chloromethyl)-6-methyl-4,5,6,7-tetrahydro-1,3-benzothiazole hydrochloride. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
2-(chloromethyl)-6-methyl-4,5,6,7-tetrahydro-1,3-benzothiazole;hydrochloride (CAS 2219407-56-2) is a chemical compound with the molecular formula C9H13Cl2NS and a molecular weight of 238.18 g/mol. IUPAC name: 2-(chloromethyl)-6-methyl-4,5,6,7-tetrahydro-1,3-benzothiazole;hydrochloride. InChIKey: WRLWTPHNADEXGC-UHFFFAOYSA-N.
| Molecular formula | C9H13Cl2NS |
|---|---|
| Molecular weight | 238.18 g/mol |
| IUPAC name | 2-(chloromethyl)-6-methyl-4,5,6,7-tetrahydro-1,3-benzothiazole;hydrochloride |
| InChIKey | WRLWTPHNADEXGC-UHFFFAOYSA-N |
| SMILES | CC1CCC2=C(C1)SC(=N2)CCl.Cl |
Computed by PubChem (NCBI)