Products 2174001-77-3

CAS 2174001-77-3 is the registry number for Ethyl 5-(piperidin-4-yl)-1,3-oxazole-4-carboxylate hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

Ethyl 5-piperidin-4-yl-1,3-oxazole-4-carboxylate;hydrochloride (CAS 2174001-77-3) is a chemical compound with the molecular formula C11H17ClN2O3 and a molecular weight of 260.72 g/mol. IUPAC name: ethyl 5-piperidin-4-yl-1,3-oxazole-4-carboxylate;hydrochloride. InChIKey: OTYREUBEHYSAQJ-UHFFFAOYSA-N.

Identity
Molecular formulaC11H17ClN2O3
Molecular weight260.72 g/mol
IUPAC nameethyl 5-piperidin-4-yl-1,3-oxazole-4-carboxylate;hydrochloride
InChIKeyOTYREUBEHYSAQJ-UHFFFAOYSA-N
SMILESCCOC(=O)C1=C(OC=N1)C2CCNCC2.Cl

Computed by PubChem (NCBI)