Products 2174007-64-6
CAS 2174007-64-6 is the registry number for 4-Amino-2,3,3-trimethyl-1λâ¶,2-thiazolidine-1,1-dione hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2,3,3-trimethyl-1,1-dioxo-1,2-thiazolidin-4-amine;hydrochloride (CAS 2174007-64-6) is a chemical compound with the molecular formula C6H15ClN2O2S and a molecular weight of 214.71 g/mol. IUPAC name: 2,3,3-trimethyl-1,1-dioxo-1,2-thiazolidin-4-amine;hydrochloride. InChIKey: SKSZHYHCHONMFX-UHFFFAOYSA-N.
| Molecular formula | C6H15ClN2O2S |
|---|---|
| Molecular weight | 214.71 g/mol |
| IUPAC name | 2,3,3-trimethyl-1,1-dioxo-1,2-thiazolidin-4-amine;hydrochloride |
| InChIKey | SKSZHYHCHONMFX-UHFFFAOYSA-N |
| SMILES | CC1(C(CS(=O)(=O)N1C)N)C.Cl |
Computed by PubChem (NCBI)