Products 2174014-64-1
CAS 2174014-64-1 appears in our catalog under these names: HBC525, HBC525, 95.40%, 95.40%. Offered by: GLPBio, Chemat. Available pack sizes: 10mg, 5mg, 1mg.
(E)-2-(1,3-benzoxazol-2-yl)-3-[4-[2-hydroxyethyl(methyl)amino]phenyl]prop-2-enenitrile (CAS 2174014-64-1) is a chemical compound with the molecular formula C19H17N3O2 and a molecular weight of 319.4 g/mol. IUPAC name: (E)-2-(1,3-benzoxazol-2-yl)-3-[4-[2-hydroxyethyl(methyl)amino]phenyl]prop-2-enenitrile. InChIKey: PARAUTMXYRINAC-NTCAYCPXSA-N.
| Molecular formula | C19H17N3O2 |
|---|---|
| Molecular weight | 319.4 g/mol |
| IUPAC name | (E)-2-(1,3-benzoxazol-2-yl)-3-[4-[2-hydroxyethyl(methyl)amino]phenyl]prop-2-enenitrile |
| InChIKey | PARAUTMXYRINAC-NTCAYCPXSA-N |
| SMILES | CN(CCO)C1=CC=C(C=C1)/C=C(\C#N)/C2=NC3=CC=CC=C3O2 |
Computed by PubChem (NCBI)