Products 1316216-05-3

CAS 1316216-05-3 is the registry number for Ethyl 2–(diphenylamino)pyrimidine–5–carboxylate. Offered by: GLPBio. Available pack sizes: 100mg, 1g, 250mg.

Structural formula: {0} (CAS {1})

Ethyl 2-(N-phenylanilino)pyrimidine-5-carboxylate (CAS 1316216-05-3) is a chemical compound with the molecular formula C19H17N3O2 and a molecular weight of 319.4 g/mol. IUPAC name: ethyl 2-(N-phenylanilino)pyrimidine-5-carboxylate. InChIKey: ZUKQDXJKYIIHBW-UHFFFAOYSA-N.

Identity
Molecular formulaC19H17N3O2
Molecular weight319.4 g/mol
IUPAC nameethyl 2-(N-phenylanilino)pyrimidine-5-carboxylate
InChIKeyZUKQDXJKYIIHBW-UHFFFAOYSA-N
SMILESCCOC(=O)C1=CN=C(N=C1)N(C2=CC=CC=C2)C3=CC=CC=C3

Computed by PubChem (NCBI)