Products 1172783-48-0
CAS 1172783-48-0 is the registry number for 1-Benzyl-4-(3-phenyl-1,2,4-oxadiazol-5-yl)pyrrolidin-2-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
1-benzyl-4-(3-phenyl-1,2,4-oxadiazol-5-yl)pyrrolidin-2-one (CAS 1172783-48-0) is a chemical compound with the molecular formula C19H17N3O2 and a molecular weight of 319.4 g/mol. IUPAC name: 1-benzyl-4-(3-phenyl-1,2,4-oxadiazol-5-yl)pyrrolidin-2-one. InChIKey: KRNICKZMXZVARN-UHFFFAOYSA-N.
| Molecular formula | C19H17N3O2 |
|---|---|
| Molecular weight | 319.4 g/mol |
| IUPAC name | 1-benzyl-4-(3-phenyl-1,2,4-oxadiazol-5-yl)pyrrolidin-2-one |
| InChIKey | KRNICKZMXZVARN-UHFFFAOYSA-N |
| SMILES | C1C(CN(C1=O)CC2=CC=CC=C2)C3=NC(=NO3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)