CAS 217482-71-8 appears in our catalog under these names: D4-beta-Damascenone, beta-Damascenone-d4. Offered by: HPC Standards, MedChemExpress. Available pack sizes: 1x5mg, Get quote.
(E)-2,4,4,4-tetradeuterio-1-(2,6,6-trimethylcyclohexa-1,3-dien-1-yl)but-2-en-1-one (CAS 217482-71-8) is a chemical compound with the molecular formula C13H18O and a molecular weight of 194.31 g/mol. IUPAC name: (E)-2,4,4,4-tetradeuterio-1-(2,6,6-trimethylcyclohexa-1,3-dien-1-yl)but-2-en-1-one. InChIKey: POIARNZEYGURDG-ZMHYPNJUSA-N.
| Molecular formula | C13H18O |
|---|---|
| Molecular weight | 194.31 g/mol |
| IUPAC name | (E)-2,4,4,4-tetradeuterio-1-(2,6,6-trimethylcyclohexa-1,3-dien-1-yl)but-2-en-1-one |
| InChIKey | POIARNZEYGURDG-ZMHYPNJUSA-N |
| SMILES | [2H]/C(=C\C([2H])([2H])[2H])/C(=O)C1=C(C=CCC1(C)C)C |
Computed by PubChem (NCBI)