CAS 21762-78-7 is the registry number for 6-Amino-3,4-dihydro-2H-1,4-benzothiazin-3-one. Offered by: Biosynth. Available pack sizes: 0,5g, 0,25g, 1g, 5g, 2g.
6-amino-4H-1,4-benzothiazin-3-one (CAS 21762-78-7) is a chemical compound with the molecular formula C8H8N2OS and a molecular weight of 180.23 g/mol. IUPAC name: 6-amino-4H-1,4-benzothiazin-3-one. InChIKey: OTAZYXUGSKFPHN-UHFFFAOYSA-N.
| Molecular formula | C8H8N2OS |
|---|---|
| Molecular weight | 180.23 g/mol |
| IUPAC name | 6-amino-4H-1,4-benzothiazin-3-one |
| InChIKey | OTAZYXUGSKFPHN-UHFFFAOYSA-N |
| SMILES | C1C(=O)NC2=C(S1)C=CC(=C2)N |
Computed by PubChem (NCBI)