CAS 217657-34-6 appears in our catalog under these names: Levodopa Impurity 8, L-DOPA-4’-Sulfate, L-Dopa-4-sulfate. Offered by: Chemat Brand, TRC, Biosynth. Available pack sizes: on request, 100mg, 50mg, 25mg.
(2S)-2-amino-3-(3-hydroxy-4-sulfooxyphenyl)propanoic acid (CAS 217657-34-6) is a chemical compound with the molecular formula C9H11NO7S and a molecular weight of 277.25 g/mol. IUPAC name: (2S)-2-amino-3-(3-hydroxy-4-sulfooxyphenyl)propanoic acid. InChIKey: KKZVNIAHQBJWCU-LURJTMIESA-N.
| Molecular formula | C9H11NO7S |
|---|---|
| Molecular weight | 277.25 g/mol |
| IUPAC name | (2S)-2-amino-3-(3-hydroxy-4-sulfooxyphenyl)propanoic acid |
| InChIKey | KKZVNIAHQBJWCU-LURJTMIESA-N |
| SMILES | C1=CC(=C(C=C1C[C@@H](C(=O)O)N)O)OS(=O)(=O)O |
Computed by PubChem (NCBI)