Products 918822-70-5

CAS 918822-70-5 is the registry number for Carbonic Acid 2,5-Dioxo-1-pyrrolidinyl 2-(Ethenylsulfonyl)ethyl Ester. Offered by: TRC. Available pack sizes: 500mg, 50mg.

Structural formula: {0} (CAS {1})

(2,5-dioxopyrrolidin-1-yl) 2-ethenylsulfonylethyl carbonate (CAS 918822-70-5) is a chemical compound with the molecular formula C9H11NO7S and a molecular weight of 277.25 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 2-ethenylsulfonylethyl carbonate. InChIKey: SJPUQNFPDYCHBX-UHFFFAOYSA-N.

Identity
Molecular formulaC9H11NO7S
Molecular weight277.25 g/mol
IUPAC name(2,5-dioxopyrrolidin-1-yl) 2-ethenylsulfonylethyl carbonate
InChIKeySJPUQNFPDYCHBX-UHFFFAOYSA-N
SMILESC=CS(=O)(=O)CCOC(=O)ON1C(=O)CCC1=O

Computed by PubChem (NCBI)