CAS 2177264-65-0 is the registry number for tert-Butyl 1-imino-1l6,4-thiazepane-4-carboxylate 1-oxide, 95%. Offered by: AmBeed. Available pack sizes: 1g.
Tert-butyl 1-imino-1-oxo-1,4-thiazepane-4-carboxylate (CAS 2177264-65-0) is a chemical compound with the molecular formula C10H20N2O3S and a molecular weight of 248.34 g/mol. IUPAC name: tert-butyl 1-imino-1-oxo-1,4-thiazepane-4-carboxylate. InChIKey: ANFFOJIDNCDHGM-UHFFFAOYSA-N.
| Molecular formula | C10H20N2O3S |
|---|---|
| Molecular weight | 248.34 g/mol |
| IUPAC name | tert-butyl 1-imino-1-oxo-1,4-thiazepane-4-carboxylate |
| InChIKey | ANFFOJIDNCDHGM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCCS(=N)(=O)CC1 |
Computed by PubChem (NCBI)