CAS 2230803-89-9 is the registry number for tert-Butyl N-(1-imino-1-oxo-1λâ¶-thian-4-yl)carbamate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Tert-butyl N-(1-imino-1-oxothian-4-yl)carbamate (CAS 2230803-89-9) is a chemical compound with the molecular formula C10H20N2O3S and a molecular weight of 248.34 g/mol. IUPAC name: tert-butyl N-(1-imino-1-oxothian-4-yl)carbamate. InChIKey: PTNMOQLQSHZUNJ-UHFFFAOYSA-N.
| Molecular formula | C10H20N2O3S |
|---|---|
| Molecular weight | 248.34 g/mol |
| IUPAC name | tert-butyl N-(1-imino-1-oxothian-4-yl)carbamate |
| InChIKey | PTNMOQLQSHZUNJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1CCS(=N)(=O)CC1 |
Computed by PubChem (NCBI)