CAS 217817-01-1 appears in our catalog under these names: Tos-peg4-t-butyl ester, 95%, Tos–PEG4–t–butyl ester, 1,1-Dimethylethyl 3-[2-[2-[2-[[(4-methylphenyl)sulfonyl]oxy]ethoxy]ethoxy]ethoxy]propanoate, 95%, 95%, Tos-PEG4-t-butyl ester, 99.46%, Tos-PEG4-t-Butyl ester, 97%. Offered by: Combi-blocks, GLPBio, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 1g, 250mg, 10mg, 100mg, 25mg, 50mg, 5g, 1 g.
Tert-butyl 3-[2-[2-[2-(4-methylphenyl)sulfonyloxyethoxy]ethoxy]ethoxy]propanoate (CAS 217817-01-1) is a chemical compound with the molecular formula C20H32O8S and a molecular weight of 432.5 g/mol. IUPAC name: tert-butyl 3-[2-[2-[2-(4-methylphenyl)sulfonyloxyethoxy]ethoxy]ethoxy]propanoate. InChIKey: AAQWIVKRAHBPDM-UHFFFAOYSA-N.
| Molecular formula | C20H32O8S |
|---|---|
| Molecular weight | 432.5 g/mol |
| IUPAC name | tert-butyl 3-[2-[2-[2-(4-methylphenyl)sulfonyloxyethoxy]ethoxy]ethoxy]propanoate |
| InChIKey | AAQWIVKRAHBPDM-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCCOCCOCCOCCC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)