CAS 86259-89-4 appears in our catalog under these names: Thp-peg5-tos, 95%, Tos–PEG4–THP, 2-(2-(2-(2-((Tetrahydro-2H-pyran-2-yl)oxy)ethoxy)ethoxy)ethoxy)ethyl 4-methylbenzenesulfonate, 97%, 97%, Tos-PEG4-THP, 95.0%, 2-(2-(2-(2-((Tetrahydro-2H-pyran-2-yl)oxy)ethoxy)ethoxy)ethoxy)ethyl 4-methylbenzenesulfonate, 95%. Offered by: Combi-blocks, GLPBio, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 1g, 5g, 500mg, 50mg, 100mg, 250mg, 100 mg, 50 mg.
2-[2-[2-[2-(oxan-2-yloxy)ethoxy]ethoxy]ethoxy]ethyl 4-methylbenzenesulfonate (CAS 86259-89-4) is a chemical compound with the molecular formula C20H32O8S and a molecular weight of 432.5 g/mol. IUPAC name: 2-[2-[2-[2-(oxan-2-yloxy)ethoxy]ethoxy]ethoxy]ethyl 4-methylbenzenesulfonate. InChIKey: AWIUPDGEVFBSGD-UHFFFAOYSA-N.
| Molecular formula | C20H32O8S |
|---|---|
| Molecular weight | 432.5 g/mol |
| IUPAC name | 2-[2-[2-[2-(oxan-2-yloxy)ethoxy]ethoxy]ethoxy]ethyl 4-methylbenzenesulfonate |
| InChIKey | AWIUPDGEVFBSGD-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCCOCCOCCOCCOC2CCCCO2 |
Computed by PubChem (NCBI)