CAS 2179087-85-3 is the registry number for (3S,4S)-3-Methylisochroman-4-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(3S,4S)-3-methyl-3,4-dihydro-1H-isochromen-4-amine (CAS 2179087-85-3) is a chemical compound with the molecular formula C10H13NO and a molecular weight of 163.22 g/mol. IUPAC name: (3S,4S)-3-methyl-3,4-dihydro-1H-isochromen-4-amine. InChIKey: SDAAEJJCAMNMMI-OIBJUYFYSA-N.
| Molecular formula | C10H13NO |
|---|---|
| Molecular weight | 163.22 g/mol |
| IUPAC name | (3S,4S)-3-methyl-3,4-dihydro-1H-isochromen-4-amine |
| InChIKey | SDAAEJJCAMNMMI-OIBJUYFYSA-N |
| SMILES | C[C@H]1[C@H](C2=CC=CC=C2CO1)N |
Computed by PubChem (NCBI)