CAS 2180911-29-7 is the registry number for N-2-Pyridinyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide. Offered by: TRC. Available pack sizes: 500mg.
N-pyridin-2-yl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide (CAS 2180911-29-7) is a chemical compound with the molecular formula C18H21BN2O3 and a molecular weight of 324.2 g/mol. IUPAC name: N-pyridin-2-yl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide. InChIKey: LKLRQEMMBDWQJT-UHFFFAOYSA-N.
| Molecular formula | C18H21BN2O3 |
|---|---|
| Molecular weight | 324.2 g/mol |
| IUPAC name | N-pyridin-2-yl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide |
| InChIKey | LKLRQEMMBDWQJT-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)C(=O)NC3=CC=CC=N3 |
Computed by PubChem (NCBI)