CAS 864759-38-6 is the registry number for N-(Pyridin-4-yl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-pyridin-4-yl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide (CAS 864759-38-6) is a chemical compound with the molecular formula C18H21BN2O3 and a molecular weight of 324.2 g/mol. IUPAC name: N-pyridin-4-yl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide. InChIKey: XELVDNPEYWCOLM-UHFFFAOYSA-N.
| Molecular formula | C18H21BN2O3 |
|---|---|
| Molecular weight | 324.2 g/mol |
| IUPAC name | N-pyridin-4-yl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide |
| InChIKey | XELVDNPEYWCOLM-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)C(=O)NC3=CC=NC=C3 |
Computed by PubChem (NCBI)