Products 2181-97-7

CAS 2181-97-7 appears in our catalog under these names: (2-Methoxy-2-oxoethyl)triphenylphosphonium chloride, 97%, 97%, Carbomethoxymethyl triphenylphosphonium chloride, 95%, (2-Methoxy-2-oxoethyl)triphenylphosphonium chloride, 95+%. Offered by: Chemat, Combi-blocks, AmBeed. Available pack sizes: 5g, 25g, 10g, 100g, 1g.

Structural formula: {0} (CAS {1})

(2-methoxy-2-oxoethyl)-triphenylphosphanium chloride (CAS 2181-97-7) is a chemical compound with the molecular formula C21H20ClO2P and a molecular weight of 370.8 g/mol. IUPAC name: (2-methoxy-2-oxoethyl)-triphenylphosphanium chloride. InChIKey: CXCXTEMZMJZMJX-UHFFFAOYSA-M.

Identity
Molecular formulaC21H20ClO2P
Molecular weight370.8 g/mol
IUPAC name(2-methoxy-2-oxoethyl)-triphenylphosphanium chloride
InChIKeyCXCXTEMZMJZMJX-UHFFFAOYSA-M
SMILESCOC(=O)C[P+](C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3.[Cl-]

Computed by PubChem (NCBI)