CAS 36626-29-6 appears in our catalog under these names: (2-Carboxyethyl)-triphenylphosphonium Chloride, 3–(Triphenylphosphonio)propanoate hydrochloride, (2-Carboxyethyl)triphenylphosphonium chloride, 98% , (2-Carboxyethyl)triphenylphosphonium chloride, 98%, 98%, (2-carboxyethyl)(triphenyl)phosphonium chloride, 98%. Offered by: TRC, GLPBio, Thermo Scientific (Alfa Aesar), Chemat, Fluorochem. Available pack sizes: 1g, 2g, 5g, 100g, 25g, 500g, 10g.
2-carboxyethyl(triphenyl)phosphanium chloride (CAS 36626-29-6) is a chemical compound with the molecular formula C21H20ClO2P and a molecular weight of 370.8 g/mol. IUPAC name: 2-carboxyethyl(triphenyl)phosphanium chloride. InChIKey: GALLWJZTZYJVSL-UHFFFAOYSA-N.
| Molecular formula | C21H20ClO2P |
|---|---|
| Molecular weight | 370.8 g/mol |
| IUPAC name | 2-carboxyethyl(triphenyl)phosphanium chloride |
| InChIKey | GALLWJZTZYJVSL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)[P+](CCC(=O)O)(C2=CC=CC=C2)C3=CC=CC=C3.[Cl-] |
Computed by PubChem (NCBI)