CAS 2183474-92-0 is the registry number for (3-(Benzylthio)-2,5-dichlorophenyl)methanol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(3-benzylsulfanyl-2,5-dichlorophenyl)methanol (CAS 2183474-92-0) is a chemical compound with the molecular formula C14H12Cl2OS and a molecular weight of 299.2 g/mol. IUPAC name: (3-benzylsulfanyl-2,5-dichlorophenyl)methanol. InChIKey: FHFUISPPDIXXNF-UHFFFAOYSA-N.
| Molecular formula | C14H12Cl2OS |
|---|---|
| Molecular weight | 299.2 g/mol |
| IUPAC name | (3-benzylsulfanyl-2,5-dichlorophenyl)methanol |
| InChIKey | FHFUISPPDIXXNF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CSC2=CC(=CC(=C2Cl)CO)Cl |
Computed by PubChem (NCBI)