CAS 2404733-67-9 appears in our catalog under these names: (4-(Benzyloxy)-3,5-dichlorophenyl)(methyl)sulfane, 95%, (4-(Benzyloxy)-3,5-dichlorophenyl)(methyl)sulfane, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
1,3-dichloro-5-methylsulfanyl-2-phenylmethoxybenzene (CAS 2404733-67-9) is a chemical compound with the molecular formula C14H12Cl2OS and a molecular weight of 299.2 g/mol. IUPAC name: 1,3-dichloro-5-methylsulfanyl-2-phenylmethoxybenzene. InChIKey: RCMLYVXHQOPHNS-UHFFFAOYSA-N.
| Molecular formula | C14H12Cl2OS |
|---|---|
| Molecular weight | 299.2 g/mol |
| IUPAC name | 1,3-dichloro-5-methylsulfanyl-2-phenylmethoxybenzene |
| InChIKey | RCMLYVXHQOPHNS-UHFFFAOYSA-N |
| SMILES | CSC1=CC(=C(C(=C1)Cl)OCC2=CC=CC=C2)Cl |
Computed by PubChem (NCBI)