Products 2185788-98-9
CAS 2185788-98-9 is the registry number for 2-(5-Methoxy-2-(p-tolylsulfinyl)phenyl)-4,4-dimethyl-4,5-dihydrooxazole, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[5-methoxy-2-(4-methylphenyl)sulfinylphenyl]-4,4-dimethyl-5H-1,3-oxazole (CAS 2185788-98-9) is a chemical compound with the molecular formula C19H21NO3S and a molecular weight of 343.4 g/mol. IUPAC name: 2-[5-methoxy-2-(4-methylphenyl)sulfinylphenyl]-4,4-dimethyl-5H-1,3-oxazole. InChIKey: SNPQNADLAFDLKZ-UHFFFAOYSA-N.
| Molecular formula | C19H21NO3S |
|---|---|
| Molecular weight | 343.4 g/mol |
| IUPAC name | 2-[5-methoxy-2-(4-methylphenyl)sulfinylphenyl]-4,4-dimethyl-5H-1,3-oxazole |
| InChIKey | SNPQNADLAFDLKZ-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)C2=C(C=C(C=C2)OC)C3=NC(CO3)(C)C |
Computed by PubChem (NCBI)