CAS 902516-53-4 is the registry number for 8-Methyl-4-oxo-N,N-dipropyl-4H-thieno[3,2-c]chromene-2-carboxamide. Offered by: MedChemExpress. Available pack sizes: Get quote.
8-methyl-4-oxo-N,N-dipropylthieno[3,2-c]chromene-2-carboxamide (CAS 902516-53-4) is a chemical compound with the molecular formula C19H21NO3S and a molecular weight of 343.4 g/mol. IUPAC name: 8-methyl-4-oxo-N,N-dipropylthieno[3,2-c]chromene-2-carboxamide. InChIKey: INVYENVHWPZHKP-UHFFFAOYSA-N.
| Molecular formula | C19H21NO3S |
|---|---|
| Molecular weight | 343.4 g/mol |
| IUPAC name | 8-methyl-4-oxo-N,N-dipropylthieno[3,2-c]chromene-2-carboxamide |
| InChIKey | INVYENVHWPZHKP-UHFFFAOYSA-N |
| SMILES | CCCN(CCC)C(=O)C1=CC2=C(S1)C3=C(C=CC(=C3)C)OC2=O |
Computed by PubChem (NCBI)