Products 2185980-35-0
CAS 2185980-35-0 is the registry number for 1-(3-(Methylsulfonyl)azetidin-1-yl)prop-2-en-1-one. Offered by: TRC. Available pack sizes: 250mg.
1-(3-methylsulfonylazetidin-1-yl)prop-2-en-1-one (CAS 2185980-35-0) is a chemical compound with the molecular formula C7H11NO3S and a molecular weight of 189.23 g/mol. IUPAC name: 1-(3-methylsulfonylazetidin-1-yl)prop-2-en-1-one. InChIKey: OYDXKDGNTPWWAJ-UHFFFAOYSA-N.
| Molecular formula | C7H11NO3S |
|---|---|
| Molecular weight | 189.23 g/mol |
| IUPAC name | 1-(3-methylsulfonylazetidin-1-yl)prop-2-en-1-one |
| InChIKey | OYDXKDGNTPWWAJ-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1CN(C1)C(=O)C=C |
Computed by PubChem (NCBI)