CAS 79438-16-7 is the registry number for (3S)-6,6-Dimethyl-5-oxothiomorpholine-3-carboxylic acid, 98%. Offered by: AmBeed. Available pack sizes: 5g, 10g.
(3S)-6,6-dimethyl-5-oxothiomorpholine-3-carboxylic acid (CAS 79438-16-7) is a chemical compound with the molecular formula C7H11NO3S and a molecular weight of 189.23 g/mol. IUPAC name: (3S)-6,6-dimethyl-5-oxothiomorpholine-3-carboxylic acid. InChIKey: GWMBJMYQZAVSRN-SCSAIBSYSA-N.
| Molecular formula | C7H11NO3S |
|---|---|
| Molecular weight | 189.23 g/mol |
| IUPAC name | (3S)-6,6-dimethyl-5-oxothiomorpholine-3-carboxylic acid |
| InChIKey | GWMBJMYQZAVSRN-SCSAIBSYSA-N |
| SMILES | CC1(C(=O)N[C@H](CS1)C(=O)O)C |
Computed by PubChem (NCBI)