Products 2187374-12-3

CAS 2187374-12-3 is the registry number for 2-(Prop-2-yn-1-yloxy)-4-(3-(trifluoromethyl)-3H-diazirin-3-yl)benzoic acid, 98%, 98%. Offered by: Chemat. Available pack sizes: 10mg, 50mg, 100mg.

Structural formula: {0} (CAS {1})

2-prop-2-ynoxy-4-[3-(trifluoromethyl)diazirin-3-yl]benzoic acid (CAS 2187374-12-3) is a chemical compound with the molecular formula C12H7F3N2O3 and a molecular weight of 284.19 g/mol. IUPAC name: 2-prop-2-ynoxy-4-[3-(trifluoromethyl)diazirin-3-yl]benzoic acid. InChIKey: NNGSWZWUOPOVNB-UHFFFAOYSA-N.

Identity
Molecular formulaC12H7F3N2O3
Molecular weight284.19 g/mol
IUPAC name2-prop-2-ynoxy-4-[3-(trifluoromethyl)diazirin-3-yl]benzoic acid
InChIKeyNNGSWZWUOPOVNB-UHFFFAOYSA-N
SMILESC#CCOC1=C(C=CC(=C1)C2(N=N2)C(F)(F)F)C(=O)O

Computed by PubChem (NCBI)