CAS 518057-62-0 appears in our catalog under these names: 3-(3-(Trifluoromethyl)phenoxy)pyrazine-2-carboxylic acid, 3-[3-(Trifluoromethyl)phenoxy]pyrazine-2-carboxylic acid. Offered by: Biosynth, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
3-[3-(trifluoromethyl)phenoxy]pyrazine-2-carboxylic acid (CAS 518057-62-0) is a chemical compound with the molecular formula C12H7F3N2O3 and a molecular weight of 284.19 g/mol. IUPAC name: 3-[3-(trifluoromethyl)phenoxy]pyrazine-2-carboxylic acid. InChIKey: QCVLWOOQXHZABF-UHFFFAOYSA-N.
| Molecular formula | C12H7F3N2O3 |
|---|---|
| Molecular weight | 284.19 g/mol |
| IUPAC name | 3-[3-(trifluoromethyl)phenoxy]pyrazine-2-carboxylic acid |
| InChIKey | QCVLWOOQXHZABF-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)OC2=NC=CN=C2C(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)