Products 21882-29-1
CAS 21882-29-1 is the registry number for 6-chloro-4-phenyl-1,2-dihydroquinazoline. Offered by: Chemat Brand. Available pack sizes: on request.
6-chloro-4-phenyl-1,2-dihydroquinazoline (CAS 21882-29-1) is a chemical compound with the molecular formula C14H11ClN2 and a molecular weight of 242.70 g/mol. IUPAC name: 6-chloro-4-phenyl-1,2-dihydroquinazoline. InChIKey: MUFVAKXJNFVOHI-UHFFFAOYSA-N.
| Molecular formula | C14H11ClN2 |
|---|---|
| Molecular weight | 242.70 g/mol |
| IUPAC name | 6-chloro-4-phenyl-1,2-dihydroquinazoline |
| InChIKey | MUFVAKXJNFVOHI-UHFFFAOYSA-N |
| SMILES | C1NC2=C(C=C(C=C2)Cl)C(=N1)C3=CC=CC=C3 |
Computed by PubChem (NCBI)