CAS 21888-98-2 appears in our catalog under these names: Dexetimide, Dexetimide, 99.20%, 99.20%, Dexetimide, 99.94%. Offered by: TargetMol, Chemat, MedChemExpress. Available pack sizes: 2mg, 5mg, 10mg, 10mM/1mL, 100 mg, 25 mg, 5 mg, 50 mg.
(3S)-3-(1-benzylpiperidin-4-yl)-3-phenylpiperidine-2,6-dione (CAS 21888-98-2) is a chemical compound with the molecular formula C23H26N2O2 and a molecular weight of 362.5 g/mol. IUPAC name: (3S)-3-(1-benzylpiperidin-4-yl)-3-phenylpiperidine-2,6-dione. InChIKey: LQQIVYSCPWCSSD-HSZRJFAPSA-N.
| Molecular formula | C23H26N2O2 |
|---|---|
| Molecular weight | 362.5 g/mol |
| IUPAC name | (3S)-3-(1-benzylpiperidin-4-yl)-3-phenylpiperidine-2,6-dione |
| InChIKey | LQQIVYSCPWCSSD-HSZRJFAPSA-N |
| SMILES | C1CN(CCC1[C@@]2(CCC(=O)NC2=O)C3=CC=CC=C3)CC4=CC=CC=C4 |
Computed by PubChem (NCBI)