CAS 218938-62-6 is the registry number for H–Tyr(tBu)–allyl ester · HCl. Offered by: GLPBio. Available pack sizes: 1g, 5g.
Prop-2-enyl (2S)-2-amino-3-[4-[(2-methylpropan-2-yl)oxy]phenyl]propanoate;hydrochloride (CAS 218938-62-6) is a chemical compound with the molecular formula C16H24ClNO3 and a molecular weight of 313.82 g/mol. IUPAC name: prop-2-enyl (2S)-2-amino-3-[4-[(2-methylpropan-2-yl)oxy]phenyl]propanoate;hydrochloride. InChIKey: XUFOSDWVNYYLBH-UQKRIMTDSA-N.
| Molecular formula | C16H24ClNO3 |
|---|---|
| Molecular weight | 313.82 g/mol |
| IUPAC name | prop-2-enyl (2S)-2-amino-3-[4-[(2-methylpropan-2-yl)oxy]phenyl]propanoate;hydrochloride |
| InChIKey | XUFOSDWVNYYLBH-UQKRIMTDSA-N |
| SMILES | CC(C)(C)OC1=CC=C(C=C1)C[C@@H](C(=O)OCC=C)N.Cl |
Computed by PubChem (NCBI)