CAS 2189700-03-4 is the registry number for PSB-17365. Offered by: MedChemExpress. Available pack sizes: Get quote.
6-[2-(4-bromophenyl)ethylamino]-1H-pyrimidine-2,4-dione (CAS 2189700-03-4) is a chemical compound with the molecular formula C12H12BrN3O2 and a molecular weight of 310.15 g/mol. IUPAC name: 6-[2-(4-bromophenyl)ethylamino]-1H-pyrimidine-2,4-dione. InChIKey: XGNIAOMGYRRHNY-UHFFFAOYSA-N.
| Molecular formula | C12H12BrN3O2 |
|---|---|
| Molecular weight | 310.15 g/mol |
| IUPAC name | 6-[2-(4-bromophenyl)ethylamino]-1H-pyrimidine-2,4-dione |
| InChIKey | XGNIAOMGYRRHNY-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CCNC2=CC(=O)NC(=O)N2)Br |
Computed by PubChem (NCBI)