CAS 21902-34-1 appears in our catalog under these names: 2–Chloro–4,6–di–p–tolyl–1,3,5–triazine, 2-Chloro-4,6-di-p-tolyl-1,3,5-triazine, >98.0%(GC), 2-Chloro-4,6-di-p-tolyl-1,3,5-triazine, 95%, 95%, 2-Chloro-4,6-di-p-tolyl-1,3,5-triazine. Offered by: GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg.
2-chloro-4,6-bis(4-methylphenyl)-1,3,5-triazine (CAS 21902-34-1) is a chemical compound with the molecular formula C17H14ClN3 and a molecular weight of 295.8 g/mol. IUPAC name: 2-chloro-4,6-bis(4-methylphenyl)-1,3,5-triazine. InChIKey: LPSLMIOUKRPZDC-UHFFFAOYSA-N.
| Molecular formula | C17H14ClN3 |
|---|---|
| Molecular weight | 295.8 g/mol |
| IUPAC name | 2-chloro-4,6-bis(4-methylphenyl)-1,3,5-triazine |
| InChIKey | LPSLMIOUKRPZDC-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=NC(=NC(=N2)Cl)C3=CC=C(C=C3)C |
Computed by PubChem (NCBI)