CAS 78941-34-1 is the registry number for 2–Chloro–4,6–bis(2–methylphenyl)–1,3,5–Triazine. Offered by: GLPBio. Available pack sizes: 1g, 5g.
2-chloro-4,6-bis(2-methylphenyl)-1,3,5-triazine (CAS 78941-34-1) is a chemical compound with the molecular formula C17H14ClN3 and a molecular weight of 295.8 g/mol. IUPAC name: 2-chloro-4,6-bis(2-methylphenyl)-1,3,5-triazine. InChIKey: AUHYHZJNJWMKAR-UHFFFAOYSA-N.
| Molecular formula | C17H14ClN3 |
|---|---|
| Molecular weight | 295.8 g/mol |
| IUPAC name | 2-chloro-4,6-bis(2-methylphenyl)-1,3,5-triazine |
| InChIKey | AUHYHZJNJWMKAR-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC=C1C2=NC(=NC(=N2)Cl)C3=CC=CC=C3C |
Computed by PubChem (NCBI)