CAS 2190502-57-7 appears in our catalog under these names: ARN19874, ARN19874, 99.54%. Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 500ug, 10mM (in 1ml dmso), 25mg, 50mg, 10mM/1mL.
2,4-dioxo-N-(4-pyridin-4-ylphenyl)-1H-quinazoline-6-sulfonamide (CAS 2190502-57-7) is a chemical compound with the molecular formula C19H14N4O4S and a molecular weight of 394.4 g/mol. IUPAC name: 2,4-dioxo-N-(4-pyridin-4-ylphenyl)-1H-quinazoline-6-sulfonamide. InChIKey: OPBGIIQHYNFABO-UHFFFAOYSA-N.
| Molecular formula | C19H14N4O4S |
|---|---|
| Molecular weight | 394.4 g/mol |
| IUPAC name | 2,4-dioxo-N-(4-pyridin-4-ylphenyl)-1H-quinazoline-6-sulfonamide |
| InChIKey | OPBGIIQHYNFABO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC=NC=C2)NS(=O)(=O)C3=CC4=C(C=C3)NC(=O)NC4=O |
Computed by PubChem (NCBI)