Products 731793-27-4
CAS 731793-27-4 is the registry number for Antimicrobial agent-29. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-[[2-[[5-(1H-indol-3-yl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetyl]amino]benzoic acid (CAS 731793-27-4) is a chemical compound with the molecular formula C19H14N4O4S and a molecular weight of 394.4 g/mol. IUPAC name: 4-[[2-[[5-(1H-indol-3-yl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetyl]amino]benzoic acid. InChIKey: DHEYLYPADJBRNO-UHFFFAOYSA-N.
| Molecular formula | C19H14N4O4S |
|---|---|
| Molecular weight | 394.4 g/mol |
| IUPAC name | 4-[[2-[[5-(1H-indol-3-yl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetyl]amino]benzoic acid |
| InChIKey | DHEYLYPADJBRNO-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2)C3=NN=C(O3)SCC(=O)NC4=CC=C(C=C4)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
Antimicrobial agent-29, orb2566984