CAS 2190680-18-1 appears in our catalog under these names: 3-(4-(Methylsulfonyl)-1-piperazinyl)-1,2-benzisothiazole, Lurasidone Impurity 23. Offered by: TRC, Biosynth, Chemat Brand. Available pack sizes: 500mg, on request.
3-(4-methylsulfonylpiperazin-1-yl)-1,2-benzothiazole (CAS 2190680-18-1) is a chemical compound with the molecular formula C12H15N3O2S2 and a molecular weight of 297.4 g/mol. IUPAC name: 3-(4-methylsulfonylpiperazin-1-yl)-1,2-benzothiazole. InChIKey: LPOGLSYQBISWGK-UHFFFAOYSA-N.
| Molecular formula | C12H15N3O2S2 |
|---|---|
| Molecular weight | 297.4 g/mol |
| IUPAC name | 3-(4-methylsulfonylpiperazin-1-yl)-1,2-benzothiazole |
| InChIKey | LPOGLSYQBISWGK-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)N1CCN(CC1)C2=NSC3=CC=CC=C32 |
Computed by PubChem (NCBI)