CAS 854058-33-6 is the registry number for 6-(Piperidine-1-sulfonyl)-benzothiazol-2-ylamine, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 250mg, 1g.
6-piperidin-1-ylsulfonyl-1,3-benzothiazol-2-amine (CAS 854058-33-6) is a chemical compound with the molecular formula C12H15N3O2S2 and a molecular weight of 297.4 g/mol. IUPAC name: 6-piperidin-1-ylsulfonyl-1,3-benzothiazol-2-amine. InChIKey: ZKIZHBKUIJEGEO-UHFFFAOYSA-N.
| Molecular formula | C12H15N3O2S2 |
|---|---|
| Molecular weight | 297.4 g/mol |
| IUPAC name | 6-piperidin-1-ylsulfonyl-1,3-benzothiazol-2-amine |
| InChIKey | ZKIZHBKUIJEGEO-UHFFFAOYSA-N |
| SMILES | C1CCN(CC1)S(=O)(=O)C2=CC3=C(C=C2)N=C(S3)N |
Computed by PubChem (NCBI)