Products 2191434-21-4
CAS 2191434-21-4 is the registry number for 6-Bromo-2-chloro-4-fluoro-1-methyl-1H-benzo[d]imidazole, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 500mg, 1g.
6-bromo-2-chloro-4-fluoro-1-methylbenzimidazole (CAS 2191434-21-4) is a chemical compound with the molecular formula C8H5BrClFN2 and a molecular weight of 263.49 g/mol. IUPAC name: 6-bromo-2-chloro-4-fluoro-1-methylbenzimidazole. InChIKey: CHQCXFJAYKLSJN-UHFFFAOYSA-N.
| Molecular formula | C8H5BrClFN2 |
|---|---|
| Molecular weight | 263.49 g/mol |
| IUPAC name | 6-bromo-2-chloro-4-fluoro-1-methylbenzimidazole |
| InChIKey | CHQCXFJAYKLSJN-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C(=CC(=C2)Br)F)N=C1Cl |
Computed by PubChem (NCBI)