CAS 2192790-34-2 is the registry number for N-(5-Chloro-2-nitrobenzyl) phthalimide, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
2-[(5-chloro-2-nitrophenyl)methyl]isoindole-1,3-dione (CAS 2192790-34-2) is a chemical compound with the molecular formula C15H9ClN2O4 and a molecular weight of 316.69 g/mol. IUPAC name: 2-[(5-chloro-2-nitrophenyl)methyl]isoindole-1,3-dione. InChIKey: URYQENOVXBPFLT-UHFFFAOYSA-N.
| Molecular formula | C15H9ClN2O4 |
|---|---|
| Molecular weight | 316.69 g/mol |
| IUPAC name | 2-[(5-chloro-2-nitrophenyl)methyl]isoindole-1,3-dione |
| InChIKey | URYQENOVXBPFLT-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)CC3=C(C=CC(=C3)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)