CAS 554404-36-3 appears in our catalog under these names: 2-Chloro-n-(4'-cyano-[2,2':3',2'']terfuran-5'-yl)-acetamide, 95%, 2-Chloro-N-(3-cyano-4,5-bis(furan-2-yl)furan-2-yl)acetamide, 95%, 2-Chloro-N-(3-cyano-4,5-bis(furan-2-yl)furan-2-yl)acetamide. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg, 2,5g.
2-chloro-N-[3-cyano-4,5-bis(furan-2-yl)furan-2-yl]acetamide (CAS 554404-36-3) is a chemical compound with the molecular formula C15H9ClN2O4 and a molecular weight of 316.69 g/mol. IUPAC name: 2-chloro-N-[3-cyano-4,5-bis(furan-2-yl)furan-2-yl]acetamide. InChIKey: VZSZEDDJEQERHY-UHFFFAOYSA-N.
| Molecular formula | C15H9ClN2O4 |
|---|---|
| Molecular weight | 316.69 g/mol |
| IUPAC name | 2-chloro-N-[3-cyano-4,5-bis(furan-2-yl)furan-2-yl]acetamide |
| InChIKey | VZSZEDDJEQERHY-UHFFFAOYSA-N |
| SMILES | C1=COC(=C1)C2=C(OC(=C2C#N)NC(=O)CCl)C3=CC=CO3 |
Computed by PubChem (NCBI)