CAS 219305-27-8 is the registry number for 4-(2,6,7-Trihydroxy-3-oxo-3H-xanthen-9-yl)benzoic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(2,3,7-trihydroxy-6-oxoxanthen-9-yl)benzoic acid (CAS 219305-27-8) is a chemical compound with the molecular formula C20H12O7 and a molecular weight of 364.3 g/mol. IUPAC name: 4-(2,3,7-trihydroxy-6-oxoxanthen-9-yl)benzoic acid. InChIKey: FUHHRYSTEFPENO-UHFFFAOYSA-N.
| Molecular formula | C20H12O7 |
|---|---|
| Molecular weight | 364.3 g/mol |
| IUPAC name | 4-(2,3,7-trihydroxy-6-oxoxanthen-9-yl)benzoic acid |
| InChIKey | FUHHRYSTEFPENO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=C3C=C(C(=O)C=C3OC4=CC(=C(C=C42)O)O)O)C(=O)O |
Computed by PubChem (NCBI)