Products 219305-27-8

CAS 219305-27-8 is the registry number for 4-(2,6,7-Trihydroxy-3-oxo-3H-xanthen-9-yl)benzoic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.

4-(2,3,7-trihydroxy-6-oxoxanthen-9-yl)benzoic acid (CAS 219305-27-8) is a chemical compound with the molecular formula C20H12O7 and a molecular weight of 364.3 g/mol. IUPAC name: 4-(2,3,7-trihydroxy-6-oxoxanthen-9-yl)benzoic acid. InChIKey: FUHHRYSTEFPENO-UHFFFAOYSA-N.

Identity
Molecular formulaC20H12O7
Molecular weight364.3 g/mol
IUPAC name4-(2,3,7-trihydroxy-6-oxoxanthen-9-yl)benzoic acid
InChIKeyFUHHRYSTEFPENO-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1C2=C3C=C(C(=O)C=C3OC4=CC(=C(C=C42)O)O)O)C(=O)O

Computed by PubChem (NCBI)