CAS 518-41-2 is the registry number for 2-(4,5,6-Trihydroxy-3-oxo-3H-xanthen-9-yl)benzoic acid. Offered by: Chemat. Available pack sizes: 25mg.
2-(3,4,5-trihydroxy-6-oxoxanthen-9-yl)benzoic acid (CAS 518-41-2) is a chemical compound with the molecular formula C20H12O7 and a molecular weight of 364.3 g/mol. IUPAC name: 2-(3,4,5-trihydroxy-6-oxoxanthen-9-yl)benzoic acid. InChIKey: QCGYJIWVJKJCCH-UHFFFAOYSA-N.
| Molecular formula | C20H12O7 |
|---|---|
| Molecular weight | 364.3 g/mol |
| IUPAC name | 2-(3,4,5-trihydroxy-6-oxoxanthen-9-yl)benzoic acid |
| InChIKey | QCGYJIWVJKJCCH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=C3C=CC(=O)C(=C3OC4=C2C=CC(=C4O)O)O)C(=O)O |
Computed by PubChem (NCBI)