Products 2193051-85-1
CAS 2193051-85-1 is the registry number for (4S)-6,8-Dimethyl-3,4-dihydro-2H-1-benzopyran-4-amine hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(4S)-6,8-dimethyl-3,4-dihydro-2H-chromen-4-amine;hydrochloride (CAS 2193051-85-1) is a chemical compound with the molecular formula C11H16ClNO and a molecular weight of 213.70 g/mol. IUPAC name: (4S)-6,8-dimethyl-3,4-dihydro-2H-chromen-4-amine;hydrochloride. InChIKey: TWWDBMGTFMHGPX-PPHPATTJSA-N.
| Molecular formula | C11H16ClNO |
|---|---|
| Molecular weight | 213.70 g/mol |
| IUPAC name | (4S)-6,8-dimethyl-3,4-dihydro-2H-chromen-4-amine;hydrochloride |
| InChIKey | TWWDBMGTFMHGPX-PPHPATTJSA-N |
| SMILES | CC1=CC(=C2C(=C1)[C@H](CCO2)N)C.Cl |
Computed by PubChem (NCBI)