CAS 2193051-90-8 is the registry number for ((3S,5R)-3-(Aminomethyl)-4-benzyl-5-methylmorpholin-3-yl)methanol. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
[(3S,5R)-3-(aminomethyl)-4-benzyl-5-methylmorpholin-3-yl]methanol (CAS 2193051-90-8) is a chemical compound with the molecular formula C14H22N2O2 and a molecular weight of 250.34 g/mol. IUPAC name: [(3S,5R)-3-(aminomethyl)-4-benzyl-5-methylmorpholin-3-yl]methanol. InChIKey: PBQPLOLJXULZHN-OCCSQVGLSA-N.
| Molecular formula | C14H22N2O2 |
|---|---|
| Molecular weight | 250.34 g/mol |
| IUPAC name | [(3S,5R)-3-(aminomethyl)-4-benzyl-5-methylmorpholin-3-yl]methanol |
| InChIKey | PBQPLOLJXULZHN-OCCSQVGLSA-N |
| SMILES | C[C@@H]1COC[C@](N1CC2=CC=CC=C2)(CN)CO |
Computed by PubChem (NCBI)